C27H43N3O3 — CID 145281618
tert-butyl N-[5-(6-methyl-1-propan-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-5-oxopentyl]carbamate;ethane (PubChem CID 145281618) has the molecular formula C27H43N3O3 and a molecular weight of 457.66 g/mol. Its IUPAC name is tert-butyl N-[5-(6-methyl-1-propan-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-5-oxopentyl]carbamate;ethane.
| Compound Name | tert-butyl N-[5-(6-methyl-1-propan-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-5-oxopentyl]carbamate;ethane |
|---|---|
| PubChem CID | 145281618 |
| Molecular Formula | C27H43N3O3 |
| Molecular Weight | 457.66 g/mol |
| Exact Mass | 457.33 |
| IUPAC Name | tert-butyl N-[5-(6-methyl-1-propan-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-5-oxopentyl]carbamate;ethane |
| SMILES | CC.Cc1ccc2[nH]c3c(c2c1)CCN(C(=O)CCCCNC(=O)OC(C)(C)C)C3C(C)C |
| InChI | InChI=1S/C25H37N3O3.C2H6/c1-16(2)23-22-18(19-15-17(3)10-11-20(19)27-22)12-14-28(23)21(29)9-7-8-13-26-24(30)31-25(4,5)6;1-2/h10-11,15-16,23,27H,7-9,12-14H2,1-6H3,(H,26,30);1-2H3 |
| InChIKey | BTPHVRFNYPBPIL-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.66 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|