C27H43N3O4 — CID 101351215
tert-butyl (4aS,5R,10bS)-9-methyl-5-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-3,4,4a,5,6,10b-hexahydro-2H-benzo[h][1,6]naphthyridine-1-carboxylate (PubChem CID 101351215) has the molecular formula C27H43N3O4 and a molecular weight of 473.66 g/mol. Its IUPAC name is tert-butyl (4aS,5R,10bS)-9-methyl-5-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-3,4,4a,5,6,10b-hexahydro-2H-benzo[h][1,6]naphthyridine-1-carboxylate.
| Compound Name | tert-butyl (4aS,5R,10bS)-9-methyl-5-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-3,4,4a,5,6,10b-hexahydro-2H-benzo[h][1,6]naphthyridine-1-carboxylate |
|---|---|
| PubChem CID | 101351215 |
| Molecular Formula | C27H43N3O4 |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.33 |
| IUPAC Name | tert-butyl (4aS,5R,10bS)-9-methyl-5-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-3,4,4a,5,6,10b-hexahydro-2H-benzo[h][1,6]naphthyridine-1-carboxylate |
| SMILES | Cc1ccc2c(c1)[C@@H]1[C@@H](CCCN1C(=O)OC(C)(C)C)[C@@H](CCCCNC(=O)OC(C)(C)C)N2 |
| InChI | InChI=1S/C27H43N3O4/c1-18-13-14-22-20(17-18)23-19(11-10-16-30(23)25(32)34-27(5,6)7)21(29-22)12-8-9-15-28-24(31)33-26(2,3)4/h13-14,17,19,21,23,29H,8-12,15-16H2,1-7H3,(H,28,31)/t19-,21+,23-/m0/s1 |
| InChIKey | LOBFMNDWBXIJPR-WPYKKVEZSA-N |
| XLogP | 6.17 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|