C26H55B3O6 — CID 145283861
5,5-dimethyl-2-propan-2-yl-1,3,2-dioxaborinane;4,4,5,5-tetramethyl-2-propan-2-yl-1,3,2-dioxaborolane;4,4,6-trimethyl-2-propan-2-yl-1,3,2-dioxaborinane (PubChem CID 145283861) has the molecular formula C26H55B3O6 and a molecular weight of 496.16 g/mol. Its IUPAC name is 5,5-dimethyl-2-propan-2-yl-1,3,2-dioxaborinane;4,4,5,5-tetramethyl-2-propan-2-yl-1,3,2-dioxaborolane;4,4,6-trimethyl-2-propan-2-yl-1,3,2-dioxaborinane.
| Compound Name | 5,5-dimethyl-2-propan-2-yl-1,3,2-dioxaborinane;4,4,5,5-tetramethyl-2-propan-2-yl-1,3,2-dioxaborolane;4,4,6-trimethyl-2-propan-2-yl-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 145283861 |
| Molecular Formula | C26H55B3O6 |
| Molecular Weight | 496.16 g/mol |
| Exact Mass | 496.43 |
| IUPAC Name | 5,5-dimethyl-2-propan-2-yl-1,3,2-dioxaborinane;4,4,5,5-tetramethyl-2-propan-2-yl-1,3,2-dioxaborolane;4,4,6-trimethyl-2-propan-2-yl-1,3,2-dioxaborinane |
| SMILES | CC(C)B1OC(C)(C)C(C)(C)O1.CC(C)B1OCC(C)(C)CO1.CC1CC(C)(C)OB(C(C)C)O1 |
| InChI | InChI=1S/2C9H19BO2.C8H17BO2/c1-7(2)10-11-8(3)6-9(4,5)12-10;1-7(2)10-11-8(3,4)9(5,6)12-10;1-7(2)9-10-5-8(3,4)6-11-9/h7-8H,6H2,1-5H3;7H,1-6H3;7H,5-6H2,1-4H3 |
| InChIKey | UHDYGOPXNPJTSM-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.16 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|