C24H41NO7 — CID 145284299
(1S,2R,5R,6S,7R,9R,11R,13R,14R)-2-ethyl-6-hydroxy-9-methoxy-1,5,7,9,11,13,15-heptamethyl-3,17-dioxa-15-azabicyclo[12.3.0]heptadecane-4,12,16-trione (PubChem CID 145284299) has the molecular formula C24H41NO7 and a molecular weight of 455.59 g/mol. Its IUPAC name is (1S,2R,5R,6S,7R,9R,11R,13R,14R)-2-ethyl-6-hydroxy-9-methoxy-1,5,7,9,11,13,15-heptamethyl-3,17-dioxa-15-azabicyclo[12.3.0]heptadecane-4,12,16-trione.
| Compound Name | (1S,2R,5R,6S,7R,9R,11R,13R,14R)-2-ethyl-6-hydroxy-9-methoxy-1,5,7,9,11,13,15-heptamethyl-3,17-dioxa-15-azabicyclo[12.3.0]heptadecane-4,12,16-trione |
|---|---|
| PubChem CID | 145284299 |
| Molecular Formula | C24H41NO7 |
| Molecular Weight | 455.59 g/mol |
| Exact Mass | 455.29 |
| IUPAC Name | (1S,2R,5R,6S,7R,9R,11R,13R,14R)-2-ethyl-6-hydroxy-9-methoxy-1,5,7,9,11,13,15-heptamethyl-3,17-dioxa-15-azabicyclo[12.3.0]heptadecane-4,12,16-trione |
| SMILES | CC[C@H]1OC(=O)[C@H](C)[C@@H](O)[C@H](C)C[C@@](C)(OC)C[C@@H](C)C(=O)[C@H](C)[C@H]2N(C)C(=O)O[C@]12C |
| InChI | InChI=1S/C24H41NO7/c1-10-17-24(7)20(25(8)22(29)32-24)15(4)18(26)13(2)11-23(6,30-9)12-14(3)19(27)16(5)21(28)31-17/h13-17,19-20,27H,10-12H2,1-9H3/t13-,14-,15+,16-,17-,19+,20-,23+,24-/m1/s1 |
| InChIKey | KWAJXBHYDFRUHT-CWYFBQDNSA-N |
| XLogP | 3.19 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.59 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |