C25H40FNO7 — CID 59435790
(1S,2R,5S,7R,8R,9R,11R,13R,14R)-2-ethyl-5-fluoro-9-methoxy-1,5,7,8,9,11,13,15-octamethyl-3,17-dioxa-15-azabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone (PubChem CID 59435790) has the molecular formula C25H40FNO7 and a molecular weight of 485.59 g/mol. Its IUPAC name is (1S,2R,5S,7R,8R,9R,11R,13R,14R)-2-ethyl-5-fluoro-9-methoxy-1,5,7,8,9,11,13,15-octamethyl-3,17-dioxa-15-azabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone.
| Compound Name | (1S,2R,5S,7R,8R,9R,11R,13R,14R)-2-ethyl-5-fluoro-9-methoxy-1,5,7,8,9,11,13,15-octamethyl-3,17-dioxa-15-azabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone |
|---|---|
| PubChem CID | 59435790 |
| Molecular Formula | C25H40FNO7 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.28 |
| IUPAC Name | (1S,2R,5S,7R,8R,9R,11R,13R,14R)-2-ethyl-5-fluoro-9-methoxy-1,5,7,8,9,11,13,15-octamethyl-3,17-dioxa-15-azabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone |
| SMILES | CC[C@H]1OC(=O)[C@@](C)(F)C(=O)[C@H](C)[C@@H](C)[C@](C)(OC)C[C@@H](C)C(=O)[C@H](C)[C@H]2N(C)C(=O)O[C@]12C |
| InChI | InChI=1S/C25H40FNO7/c1-11-17-25(8)19(27(9)22(31)34-25)15(4)18(28)13(2)12-23(6,32-10)16(5)14(3)20(29)24(7,26)21(30)33-17/h13-17,19H,11-12H2,1-10H3/t13-,14-,15+,16-,17-,19-,23-,24+,25-/m1/s1 |
| InChIKey | BNEQCQFSQBMYNR-PXEXDSTQSA-N |
| XLogP | 3.74 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|