C21H25F4N5OS2 — CID 145285260
fluoroform;N-[(6-fluoro-4-piperidin-1-yl-3,4-dihydro-2H-chromen-7-yl)sulfanyl]-1,3-thiazol-2-amine;1H-pyrazole (PubChem CID 145285260) has the molecular formula C21H25F4N5OS2 and a molecular weight of 503.59 g/mol. Its IUPAC name is fluoroform;N-[(6-fluoro-4-piperidin-1-yl-3,4-dihydro-2H-chromen-7-yl)sulfanyl]-1,3-thiazol-2-amine;1H-pyrazole.
| Compound Name | fluoroform;N-[(6-fluoro-4-piperidin-1-yl-3,4-dihydro-2H-chromen-7-yl)sulfanyl]-1,3-thiazol-2-amine;1H-pyrazole |
|---|---|
| PubChem CID | 145285260 |
| Molecular Formula | C21H25F4N5OS2 |
| Molecular Weight | 503.59 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | fluoroform;N-[(6-fluoro-4-piperidin-1-yl-3,4-dihydro-2H-chromen-7-yl)sulfanyl]-1,3-thiazol-2-amine;1H-pyrazole |
| SMILES | FC(F)F.Fc1cc2c(cc1SNc1nccs1)OCCC2N1CCCCC1.c1cn[nH]c1 |
| InChI | InChI=1S/C17H20FN3OS2.C3H4N2.CHF3/c18-13-10-12-14(21-6-2-1-3-7-21)4-8-22-15(12)11-16(13)24-20-17-19-5-9-23-17;1-2-4-5-3-1;2-1(3)4/h5,9-11,14H,1-4,6-8H2,(H,19,20);1-3H,(H,4,5);1H |
| InChIKey | BBWFMRKADSVXLQ-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.59 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|