C12H20N2O — CID 145293590
(2Z,4Z)-N-tert-butyl-3-methyl-2-(methylideneamino)hexa-2,4-dienamide (PubChem CID 145293590) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is (2Z,4Z)-N-tert-butyl-3-methyl-2-(methylideneamino)hexa-2,4-dienamide.
| Compound Name | (2Z,4Z)-N-tert-butyl-3-methyl-2-(methylideneamino)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 145293590 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | (2Z,4Z)-N-tert-butyl-3-methyl-2-(methylideneamino)hexa-2,4-dienamide |
| SMILES | C=N/C(C(=O)NC(C)(C)C)=C(C)\C=C/C |
| InChI | InChI=1S/C12H20N2O/c1-7-8-9(2)10(13-6)11(15)14-12(3,4)5/h7-8H,6H2,1-5H3,(H,14,15)/b8-7-,10-9- |
| InChIKey | SJSKUFJENPXHOO-QRLRYFCNSA-N |
| XLogP | 2.45 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|