C27H24F2N4O2 — CID 145296015
N-[3-[4-[(3,4-difluorophenyl)methoxy]-N-methylanilino]-4-pyridinyl]-N-[3-(methylamino)phenyl]formamide (PubChem CID 145296015) has the molecular formula C27H24F2N4O2 and a molecular weight of 474.51 g/mol. Its IUPAC name is N-[3-[4-[(3,4-difluorophenyl)methoxy]-N-methylanilino]-4-pyridinyl]-N-[3-(methylamino)phenyl]formamide.
| Compound Name | N-[3-[4-[(3,4-difluorophenyl)methoxy]-N-methylanilino]-4-pyridinyl]-N-[3-(methylamino)phenyl]formamide |
|---|---|
| PubChem CID | 145296015 |
| Molecular Formula | C27H24F2N4O2 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | N-[3-[4-[(3,4-difluorophenyl)methoxy]-N-methylanilino]-4-pyridinyl]-N-[3-(methylamino)phenyl]formamide |
| SMILES | CNc1cccc(N(C=O)c2ccncc2N(C)c2ccc(OCc3ccc(F)c(F)c3)cc2)c1 |
| InChI | InChI=1S/C27H24F2N4O2/c1-30-20-4-3-5-22(15-20)33(18-34)26-12-13-31-16-27(26)32(2)21-7-9-23(10-8-21)35-17-19-6-11-24(28)25(29)14-19/h3-16,18,30H,17H2,1-2H3 |
| InChIKey | STUICIROGAUTKG-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|