C23H28 — CID 145299580
1-methyl-2-[(1E,3Z,5Z)-2-methylhepta-1,3,5-trienyl]-4-[(3Z,5Z)-4-methylhepta-1,3,5-trien-3-yl]benzene (PubChem CID 145299580) has the molecular formula C23H28 and a molecular weight of 304.48 g/mol. Its IUPAC name is 1-methyl-2-[(1E,3Z,5Z)-2-methylhepta-1,3,5-trienyl]-4-[(3Z,5Z)-4-methylhepta-1,3,5-trien-3-yl]benzene.
| Compound Name | 1-methyl-2-[(1E,3Z,5Z)-2-methylhepta-1,3,5-trienyl]-4-[(3Z,5Z)-4-methylhepta-1,3,5-trien-3-yl]benzene |
|---|---|
| PubChem CID | 145299580 |
| Molecular Formula | C23H28 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 1-methyl-2-[(1E,3Z,5Z)-2-methylhepta-1,3,5-trienyl]-4-[(3Z,5Z)-4-methylhepta-1,3,5-trien-3-yl]benzene |
| SMILES | C=C/C(=C(C)/C=C\C)c1ccc(C)c(/C=C(C)/C=C\C=C/C)c1 |
| InChI | InChI=1S/C23H28/c1-7-10-11-13-18(4)16-22-17-21(15-14-19(22)5)23(9-3)20(6)12-8-2/h7-17H,3H2,1-2,4-6H3/b10-7-,12-8-,13-11-,18-16+,23-20- |
| InChIKey | SWKJMYNEUOIWHT-PXMUCVTKSA-N |
| XLogP | 7.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|