C16H18S — CID 130349651
3-[(3E,5Z,7E)-3-methylnona-1,3,5,7-tetraen-4-yl]benzenethiol (PubChem CID 130349651) has the molecular formula C16H18S and a molecular weight of 242.39 g/mol. Its IUPAC name is 3-[(3E,5Z,7E)-3-methylnona-1,3,5,7-tetraen-4-yl]benzenethiol.
| Compound Name | 3-[(3E,5Z,7E)-3-methylnona-1,3,5,7-tetraen-4-yl]benzenethiol |
|---|---|
| PubChem CID | 130349651 |
| Molecular Formula | C16H18S |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 3-[(3E,5Z,7E)-3-methylnona-1,3,5,7-tetraen-4-yl]benzenethiol |
| SMILES | C=C/C(C)=C(\C=C/C=C/C)c1cccc(S)c1 |
| InChI | InChI=1S/C16H18S/c1-4-6-7-11-16(13(3)5-2)14-9-8-10-15(17)12-14/h4-12,17H,2H2,1,3H3/b6-4+,11-7-,16-13+ |
| InChIKey | SWJQGHWQLDHMMR-GOPTXKKASA-N |
| XLogP | 5.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|