C20H30N3P — CID 145300297
(8R)-9-methyl-5-(4-methylpiperazin-1-yl)-10-prop-2-enyl-9-aza-10-phosphatricyclo[6.4.1.02,7]trideca-2(7),3,5-triene (PubChem CID 145300297) has the molecular formula C20H30N3P and a molecular weight of 343.46 g/mol. Its IUPAC name is (8R)-9-methyl-5-(4-methylpiperazin-1-yl)-10-prop-2-enyl-9-aza-10-phosphatricyclo[6.4.1.02,7]trideca-2(7),3,5-triene.
| Compound Name | (8R)-9-methyl-5-(4-methylpiperazin-1-yl)-10-prop-2-enyl-9-aza-10-phosphatricyclo[6.4.1.02,7]trideca-2(7),3,5-triene |
|---|---|
| PubChem CID | 145300297 |
| Molecular Formula | C20H30N3P |
| Molecular Weight | 343.46 g/mol |
| Exact Mass | 343.22 |
| IUPAC Name | (8R)-9-methyl-5-(4-methylpiperazin-1-yl)-10-prop-2-enyl-9-aza-10-phosphatricyclo[6.4.1.02,7]trideca-2(7),3,5-triene |
| SMILES | C=CCP1CCC2C[C@H](c3cc(N4CCN(C)CC4)ccc32)N1C |
| InChI | InChI=1S/C20H30N3P/c1-4-12-24-13-7-16-14-20(22(24)3)19-15-17(5-6-18(16)19)23-10-8-21(2)9-11-23/h4-6,15-16,20H,1,7-14H2,2-3H3/t16?,20-,24?/m1/s1 |
| InChIKey | HCYJKGVORFFCSY-HYSRAYMDSA-N |
| XLogP | 3.89 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|