C48H46N2 — CID 145302581
(Z)-1-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]phenyl]-N'-methylidene-N-[(3-naphthalen-1-ylphenyl)methyl]-3-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]prop-2-ene-1,3-diimine;prop-1-ene (PubChem CID 145302581) has the molecular formula C48H46N2 and a molecular weight of 650.91 g/mol. Its IUPAC name is (Z)-1-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]phenyl]-N'-methylidene-N-[(3-naphthalen-1-ylphenyl)methyl]-3-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]prop-2-ene-1,3-diimine;prop-1-ene.
| Compound Name | (Z)-1-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]phenyl]-N'-methylidene-N-[(3-naphthalen-1-ylphenyl)methyl]-3-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]prop-2-ene-1,3-diimine;prop-1-ene |
|---|---|
| PubChem CID | 145302581 |
| Molecular Formula | C48H46N2 |
| Molecular Weight | 650.91 g/mol |
| Exact Mass | 650.37 |
| IUPAC Name | (Z)-1-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]phenyl]-N'-methylidene-N-[(3-naphthalen-1-ylphenyl)methyl]-3-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]prop-2-ene-1,3-diimine;prop-1-ene |
| SMILES | C=C/C(=C\C)c1ccc(/C(=C/C(=N\Cc2cccc(-c3cccc4ccccc34)c2)c2ccc(/C(C=C)=C/C=C\C)cc2)N=C)cc1.C=CC |
| InChI | InChI=1S/C45H40N2.C3H6/c1-6-10-16-35(9-4)37-24-28-40(29-25-37)45(31-44(46-5)39-26-22-36(23-27-39)34(7-2)8-3)47-32-33-15-13-19-41(30-33)43-21-14-18-38-17-11-12-20-42(38)43;1-3-2/h6-31H,2,4-5,32H2,1,3H3;3H,1H2,2H3/b10-6-,34-8+,35-16+,44-31-,47-45+; |
| InChIKey | HTVJKWYTUFAWDD-KLYFMKOJSA-N |
| XLogP | 13.16 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.91 |
| LogP ≤ 5 | 13.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|