C21H37BO3 — CID 145304530
4,4,5,5-tetramethyl-2-[4-[(Z)-3-methyl-1-(2-methylpropoxy)but-1-enyl]cyclohexen-1-yl]-1,3,2-dioxaborolane (PubChem CID 145304530) has the molecular formula C21H37BO3 and a molecular weight of 348.34 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[4-[(Z)-3-methyl-1-(2-methylpropoxy)but-1-enyl]cyclohexen-1-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[4-[(Z)-3-methyl-1-(2-methylpropoxy)but-1-enyl]cyclohexen-1-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 145304530 |
| Molecular Formula | C21H37BO3 |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.28 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[4-[(Z)-3-methyl-1-(2-methylpropoxy)but-1-enyl]cyclohexen-1-yl]-1,3,2-dioxaborolane |
| SMILES | CC(C)/C=C(\OCC(C)C)C1CC=C(B2OC(C)(C)C(C)(C)O2)CC1 |
| InChI | InChI=1S/C21H37BO3/c1-15(2)13-19(23-14-16(3)4)17-9-11-18(12-10-17)22-24-20(5,6)21(7,8)25-22/h11,13,15-17H,9-10,12,14H2,1-8H3/b19-13- |
| InChIKey | FARPQQLORHAVEL-UYRXBGFRSA-N |
| XLogP | 5.56 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|