C26H49BO3 — CID 90856636
(4R,5R)-4,5-bis(2,5-dimethylhex-3-en-2-yl)-4,5-dimethyl-2-[2-(2-methylpropoxy)ethyl]-1,3,2-dioxaborolane (PubChem CID 90856636) has the molecular formula C26H49BO3 and a molecular weight of 420.49 g/mol. Its IUPAC name is (4R,5R)-4,5-bis(2,5-dimethylhex-3-en-2-yl)-4,5-dimethyl-2-[2-(2-methylpropoxy)ethyl]-1,3,2-dioxaborolane.
| Compound Name | (4R,5R)-4,5-bis(2,5-dimethylhex-3-en-2-yl)-4,5-dimethyl-2-[2-(2-methylpropoxy)ethyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 90856636 |
| Molecular Formula | C26H49BO3 |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.38 |
| IUPAC Name | (4R,5R)-4,5-bis(2,5-dimethylhex-3-en-2-yl)-4,5-dimethyl-2-[2-(2-methylpropoxy)ethyl]-1,3,2-dioxaborolane |
| SMILES | CC(C)C=CC(C)(C)[C@@]1(C)OB(CCOCC(C)C)O[C@]1(C)C(C)(C)C=CC(C)C |
| InChI | InChI=1S/C26H49BO3/c1-20(2)13-15-23(7,8)25(11)26(12,24(9,10)16-14-21(3)4)30-27(29-25)17-18-28-19-22(5)6/h13-16,20-22H,17-19H2,1-12H3/t25-,26-/m1/s1 |
| InChIKey | HDDFLFNXUDYJNS-CLJLJLNGSA-N |
| XLogP | 7.19 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|