C12H22N2O2 — CID 145304614
ethane;methyl formate;3-methyl-4,5,6,7-tetrahydro-2H-indazole (PubChem CID 145304614) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is ethane;methyl formate;3-methyl-4,5,6,7-tetrahydro-2H-indazole.
| Compound Name | ethane;methyl formate;3-methyl-4,5,6,7-tetrahydro-2H-indazole |
|---|---|
| PubChem CID | 145304614 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | ethane;methyl formate;3-methyl-4,5,6,7-tetrahydro-2H-indazole |
| SMILES | CC.COC=O.Cc1[nH]nc2c1CCCC2 |
| InChI | InChI=1S/C8H12N2.C2H4O2.C2H6/c1-6-7-4-2-3-5-8(7)10-9-6;1-4-2-3;1-2/h2-5H2,1H3,(H,9,10);2H,1H3;1-2H3 |
| InChIKey | JCGJESLRBDSWHV-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|