About 3-methyl-2,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazole 5-oxide
3-methyl-2,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazole 5-oxide (PubChem CID 130251417) has the molecular formula C7H10N2OS
and a molecular weight of 170.24 g/mol. Its IUPAC name is 3-methyl-2,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazole 5-oxide.
Analyze 3-methyl-2,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazole 5-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazole 5-oxide?
The IUPAC name of 3-methyl-2,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazole 5-oxide (CID 130251417) is 3-methyl-2,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazole 5-oxide.
What is the SMILES notation for 3-methyl-2,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazole 5-oxide?
The canonical SMILES for 3-methyl-2,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazole 5-oxide is Cc1[nH]nc2c1CS(=O)CC2.
What is the InChIKey of 3-methyl-2,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazole 5-oxide?
The InChIKey is JTIMQNKHRHFPLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2OS/c1-5-6-4-11(10)3-2-7(6)9-8-5/h2-4H2,1H3,(H,8,9).
What are the key properties of 3-methyl-2,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazole 5-oxide?
3-methyl-2,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazole 5-oxide has a molecular weight of 170.24 g/mol, XLogP of 0.52, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazole 5-oxide is sourced from PubChem (CID 130251417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).