C10H21NO2 — CID 145305352
ethane;1-methyl-6,10-dioxa-2-azaspiro[4.5]decane (PubChem CID 145305352) has the molecular formula C10H21NO2 and a molecular weight of 187.28 g/mol. Its IUPAC name is ethane;1-methyl-6,10-dioxa-2-azaspiro[4.5]decane.
| Compound Name | ethane;1-methyl-6,10-dioxa-2-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 145305352 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | ethane;1-methyl-6,10-dioxa-2-azaspiro[4.5]decane |
| SMILES | CC.CC1NCCC12OCCCO2 |
| InChI | InChI=1S/C8H15NO2.C2H6/c1-7-8(3-4-9-7)10-5-2-6-11-8;1-2/h7,9H,2-6H2,1H3;1-2H3 |
| InChIKey | IFJMOVGRDOYWPD-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |