C32H41N3O3 — CID 145305806
N-(4-methoxycyclohexyl)-N-[3-methyl-6-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]quinolin-4-yl]acetamide (PubChem CID 145305806) has the molecular formula C32H41N3O3 and a molecular weight of 515.70 g/mol. Its IUPAC name is N-(4-methoxycyclohexyl)-N-[3-methyl-6-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]quinolin-4-yl]acetamide.
| Compound Name | N-(4-methoxycyclohexyl)-N-[3-methyl-6-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]quinolin-4-yl]acetamide |
|---|---|
| PubChem CID | 145305806 |
| Molecular Formula | C32H41N3O3 |
| Molecular Weight | 515.70 g/mol |
| Exact Mass | 515.31 |
| IUPAC Name | N-(4-methoxycyclohexyl)-N-[3-methyl-6-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]quinolin-4-yl]acetamide |
| SMILES | COC1CCC(N(C(C)=O)c2c(C)cnc3ccc(-c4ccc(OCCCN5CCCC5)cc4)cc23)CC1 |
| InChI | InChI=1S/C32H41N3O3/c1-23-22-33-31-16-9-26(25-7-12-29(13-8-25)38-20-6-19-34-17-4-5-18-34)21-30(31)32(23)35(24(2)36)27-10-14-28(37-3)15-11-27/h7-9,12-13,16,21-22,27-28H,4-6,10-11,14-15,17-20H2,1-3H3 |
| InChIKey | CJGZGZABHFJNFN-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.70 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|