C30H51N — CID 145307547
10,13-dimethyl-17-(5-methylhexyl)-N-prop-2-ynyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-amine;methane (PubChem CID 145307547) has the molecular formula C30H51N and a molecular weight of 425.75 g/mol. Its IUPAC name is 10,13-dimethyl-17-(5-methylhexyl)-N-prop-2-ynyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-amine;methane.
| Compound Name | 10,13-dimethyl-17-(5-methylhexyl)-N-prop-2-ynyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-amine;methane |
|---|---|
| PubChem CID | 145307547 |
| Molecular Formula | C30H51N |
| Molecular Weight | 425.75 g/mol |
| Exact Mass | 425.40 |
| IUPAC Name | 10,13-dimethyl-17-(5-methylhexyl)-N-prop-2-ynyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-amine;methane |
| SMILES | C.C#CCNC1CCC2(C)C(=CCC3C2CCC2(C)C(CCCCC(C)C)CCC32)C1 |
| InChI | InChI=1S/C29H47N.CH4/c1-6-19-30-24-15-17-29(5)23(20-24)11-13-25-26-14-12-22(10-8-7-9-21(2)3)28(26,4)18-16-27(25)29;/h1,11,21-22,24-27,30H,7-10,12-20H2,2-5H3;1H4 |
| InChIKey | ZADRSOBOFXAHMW-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.75 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|