C34H59NO — CID 144759443
1-[[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]amino]-3-methylheptan-4-one (PubChem CID 144759443) has the molecular formula C34H59NO and a molecular weight of 497.85 g/mol. Its IUPAC name is 1-[[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]amino]-3-methylheptan-4-one.
| Compound Name | 1-[[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]amino]-3-methylheptan-4-one |
|---|---|
| PubChem CID | 144759443 |
| Molecular Formula | C34H59NO |
| Molecular Weight | 497.85 g/mol |
| Exact Mass | 497.46 |
| IUPAC Name | 1-[[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]amino]-3-methylheptan-4-one |
| SMILES | CCCC(=O)C(C)CCNC1CCC2(C)C(=CCC3C2CCC2(C)C(CCCCC(C)C)CCC32)C1 |
| InChI | InChI=1S/C34H59NO/c1-7-10-32(36)25(4)19-22-35-28-17-20-34(6)27(23-28)13-15-29-30-16-14-26(12-9-8-11-24(2)3)33(30,5)21-18-31(29)34/h13,24-26,28-31,35H,7-12,14-23H2,1-6H3 |
| InChIKey | YVZMPRCZOROUJD-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.85 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|