C29H47NO3 — CID 174284003
3-[[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]amino]-3-oxopropanoic acid (PubChem CID 174284003) has the molecular formula C29H47NO3 and a molecular weight of 457.70 g/mol. Its IUPAC name is 3-[[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]amino]-3-oxopropanoic acid.
| Compound Name | 3-[[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]amino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 174284003 |
| Molecular Formula | C29H47NO3 |
| Molecular Weight | 457.70 g/mol |
| Exact Mass | 457.36 |
| IUPAC Name | 3-[[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]amino]-3-oxopropanoic acid |
| SMILES | CC(C)CCCCC1CCC2C3CC=C4CC(NC(=O)CC(=O)O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C29H47NO3/c1-19(2)7-5-6-8-20-10-12-24-23-11-9-21-17-22(30-26(31)18-27(32)33)13-15-29(21,4)25(23)14-16-28(20,24)3/h9,19-20,22-25H,5-8,10-18H2,1-4H3,(H,30,31)(H,32,33) |
| InChIKey | FUYXKCUNEANNBG-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.70 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|