C22H22N4 — CID 145312989
(2E,4E)-5-amino-2-methyl-4-[(11Z)-5-methylidenebenzo[d][1]benzazocin-10-yl]penta-2,4-dienimidamide (PubChem CID 145312989) has the molecular formula C22H22N4 and a molecular weight of 342.45 g/mol. Its IUPAC name is (2E,4E)-5-amino-2-methyl-4-[(11Z)-5-methylidenebenzo[d][1]benzazocin-10-yl]penta-2,4-dienimidamide.
| Compound Name | (2E,4E)-5-amino-2-methyl-4-[(11Z)-5-methylidenebenzo[d][1]benzazocin-10-yl]penta-2,4-dienimidamide |
|---|---|
| PubChem CID | 145312989 |
| Molecular Formula | C22H22N4 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | (2E,4E)-5-amino-2-methyl-4-[(11Z)-5-methylidenebenzo[d][1]benzazocin-10-yl]penta-2,4-dienimidamide |
| SMILES | [H]/N=C(N)/C(C)=C/C(=C\N)N1/C=C\c2ccccc2C(=C)c2ccccc21 |
| InChI | InChI=1S/C22H22N4/c1-15(22(24)25)13-18(14-23)26-12-11-17-7-3-4-8-19(17)16(2)20-9-5-6-10-21(20)26/h3-14H,2,23H2,1H3,(H3,24,25)/b12-11-,15-13+,18-14+ |
| InChIKey | DOSJZTCFENZMHL-FRBOZTJPSA-N |
| XLogP | 4.22 |
| TPSA | 79.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|