C18H30FO4P — CID 145315285
fluoro-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxyphosphinic acid (PubChem CID 145315285) has the molecular formula C18H30FO4P and a molecular weight of 360.41 g/mol. Its IUPAC name is fluoro-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxyphosphinic acid.
| Compound Name | fluoro-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxyphosphinic acid |
|---|---|
| PubChem CID | 145315285 |
| Molecular Formula | C18H30FO4P |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | fluoro-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxyphosphinic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OP(=O)(O)F |
| InChI | InChI=1S/C18H30FO4P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(20)23-24(19,21)22/h3-4,6-7,9-10H,2,5,8,11-17H2,1H3,(H,21,22)/b4-3-,7-6-,10-9- |
| InChIKey | UQDVFQYPOBGOKQ-PDBXOOCHSA-N |
| XLogP | 6.19 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|