C47H75BN4O13S — CID 145317554
CID 145317554 (PubChem CID 145317554) has the molecular formula C47H75BN4O13S and a molecular weight of 947.01 g/mol.
| Compound Name | CID 145317554 |
|---|---|
| PubChem CID | 145317554 |
| Molecular Formula | C47H75BN4O13S |
| Molecular Weight | 947.01 g/mol |
| Exact Mass | 946.51 |
| IUPAC Name | — |
| SMILES | [B]C(OCc1ccc(OC2CC(O)CC(C(=O)O)O2)c(C(=O)NCCCCC(NC(=O)COC(C)(C)CCOC(C)(C)CCOC)C(=O)NC(C)(C)CCOC(C)(S)N=C(C)C)c1)=C1CC1 |
| InChI | InChI=1S/C47H75BN4O13S/c1-30(2)51-47(9,66)62-23-18-44(3,4)52-42(56)35(50-38(54)29-63-46(7,8)20-24-61-45(5,6)19-22-59-10)13-11-12-21-49-41(55)34-25-31(28-60-40(48)32-15-16-32)14-17-36(34)64-39-27-33(53)26-37(65-39)43(57)58/h14,17,25,33,35,37,39,53,66H,11-13,15-16,18-24,26-29H2,1-10H3,(H,49,55)(H,50,54)(H,52,56)(H,57,58) |
| InChIKey | ZHKLBGWJELCEIZ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 221.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 66 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 947.01 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|