C18H30N2 — CID 145322463
ethane;[4,5,6-tris(ethenyl)-3-pyridinyl]methanimine (PubChem CID 145322463) has the molecular formula C18H30N2 and a molecular weight of 274.45 g/mol. Its IUPAC name is ethane;[4,5,6-tris(ethenyl)-3-pyridinyl]methanimine.
| Compound Name | ethane;[4,5,6-tris(ethenyl)-3-pyridinyl]methanimine |
|---|---|
| PubChem CID | 145322463 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | ethane;[4,5,6-tris(ethenyl)-3-pyridinyl]methanimine |
| SMILES | CC.CC.CC.[H]/N=C/c1cnc(C=C)c(C=C)c1C=C |
| InChI | InChI=1S/C12H12N2.3C2H6/c1-4-10-9(7-13)8-14-12(6-3)11(10)5-2;3*1-2/h4-8,13H,1-3H2;3*1-2H3/b13-7+;;; |
| InChIKey | LRXNEJSIGYHCDV-COBFFHJSSA-N |
| XLogP | 6.09 |
| TPSA | 36.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|