C18H14N4 — CID 163973866
[7,8-bis(ethenyl)-4-methanimidoyl-1,10-phenanthrolin-3-yl]methanimine (PubChem CID 163973866) has the molecular formula C18H14N4 and a molecular weight of 286.34 g/mol. Its IUPAC name is [7,8-bis(ethenyl)-4-methanimidoyl-1,10-phenanthrolin-3-yl]methanimine.
| Compound Name | [7,8-bis(ethenyl)-4-methanimidoyl-1,10-phenanthrolin-3-yl]methanimine |
|---|---|
| PubChem CID | 163973866 |
| Molecular Formula | C18H14N4 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | [7,8-bis(ethenyl)-4-methanimidoyl-1,10-phenanthrolin-3-yl]methanimine |
| SMILES | [H]/N=C/c1cnc2c(ccc3c(C=C)c(C=C)cnc32)c1/C=N/[H] |
| InChI | InChI=1S/C18H14N4/c1-3-11-9-21-17-14(13(11)4-2)5-6-15-16(8-20)12(7-19)10-22-18(15)17/h3-10,19-20H,1-2H2/b19-7+,20-8+ |
| InChIKey | SSJIRNUQFFQIOG-OKXCLTPOSA-N |
| XLogP | 4.06 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|