C22H26N4O6S — CID 145326105
N-hydroxy-4-[7-[4-[[methoxy(methyl)amino]methyl]phenyl]-4-oxoquinazolin-3-yl]-2-methylsulfonylbutanamide (PubChem CID 145326105) has the molecular formula C22H26N4O6S and a molecular weight of 474.54 g/mol. Its IUPAC name is N-hydroxy-4-[7-[4-[[methoxy(methyl)amino]methyl]phenyl]-4-oxoquinazolin-3-yl]-2-methylsulfonylbutanamide.
| Compound Name | N-hydroxy-4-[7-[4-[[methoxy(methyl)amino]methyl]phenyl]-4-oxoquinazolin-3-yl]-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 145326105 |
| Molecular Formula | C22H26N4O6S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | N-hydroxy-4-[7-[4-[[methoxy(methyl)amino]methyl]phenyl]-4-oxoquinazolin-3-yl]-2-methylsulfonylbutanamide |
| SMILES | CON(C)Cc1ccc(-c2ccc3c(=O)n(CCC(C(=O)NO)S(C)(=O)=O)cnc3c2)cc1 |
| InChI | InChI=1S/C22H26N4O6S/c1-25(32-2)13-15-4-6-16(7-5-15)17-8-9-18-19(12-17)23-14-26(22(18)28)11-10-20(21(27)24-29)33(3,30)31/h4-9,12,14,20,29H,10-11,13H2,1-3H3,(H,24,27) |
| InChIKey | RATZQPFGIVJHQA-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|