C20H19F2N3O5S — CID 155129166
(2R)-4-[7-[4-(difluoromethyl)phenyl]-4-oxoquinazolin-3-yl]-N-hydroxy-2-methylsulfonylbutanamide (PubChem CID 155129166) has the molecular formula C20H19F2N3O5S and a molecular weight of 451.45 g/mol. Its IUPAC name is (2R)-4-[7-[4-(difluoromethyl)phenyl]-4-oxoquinazolin-3-yl]-N-hydroxy-2-methylsulfonylbutanamide.
| Compound Name | (2R)-4-[7-[4-(difluoromethyl)phenyl]-4-oxoquinazolin-3-yl]-N-hydroxy-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 155129166 |
| Molecular Formula | C20H19F2N3O5S |
| Molecular Weight | 451.45 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | (2R)-4-[7-[4-(difluoromethyl)phenyl]-4-oxoquinazolin-3-yl]-N-hydroxy-2-methylsulfonylbutanamide |
| SMILES | CS(=O)(=O)[C@H](CCn1cnc2cc(-c3ccc(C(F)F)cc3)ccc2c1=O)C(=O)NO |
| InChI | InChI=1S/C20H19F2N3O5S/c1-31(29,30)17(19(26)24-28)8-9-25-11-23-16-10-14(6-7-15(16)20(25)27)12-2-4-13(5-3-12)18(21)22/h2-7,10-11,17-18,28H,8-9H2,1H3,(H,24,26)/t17-/m1/s1 |
| InChIKey | WXWCQSAFJRTDQT-QGZVFWFLSA-N |
| XLogP | 2.31 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|