C17H25N3O3S — CID 145330781
tert-butyl 8-amino-2,5-dihydro-1H-pyrazino[2,1-c][1,4]benzoxazine-3-carboxylate;methanethiol (PubChem CID 145330781) has the molecular formula C17H25N3O3S and a molecular weight of 351.47 g/mol. Its IUPAC name is tert-butyl 8-amino-2,5-dihydro-1H-pyrazino[2,1-c][1,4]benzoxazine-3-carboxylate;methanethiol.
| Compound Name | tert-butyl 8-amino-2,5-dihydro-1H-pyrazino[2,1-c][1,4]benzoxazine-3-carboxylate;methanethiol |
|---|---|
| PubChem CID | 145330781 |
| Molecular Formula | C17H25N3O3S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | tert-butyl 8-amino-2,5-dihydro-1H-pyrazino[2,1-c][1,4]benzoxazine-3-carboxylate;methanethiol |
| SMILES | CC(C)(C)OC(=O)N1C=C2COc3cc(N)ccc3N2CC1.CS |
| InChI | InChI=1S/C16H21N3O3.CH4S/c1-16(2,3)22-15(20)18-6-7-19-12(9-18)10-21-14-8-11(17)4-5-13(14)19;1-2/h4-5,8-9H,6-7,10,17H2,1-3H3;2H,1H3 |
| InChIKey | AVTOCJXDUGHTCG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|