C11H13N3O — CID 142373707
1,2,3,5-tetrahydropyrazino[2,1-c][1,4]benzoxazin-8-amine (PubChem CID 142373707) has the molecular formula C11H13N3O and a molecular weight of 203.25 g/mol. Its IUPAC name is 1,2,3,5-tetrahydropyrazino[2,1-c][1,4]benzoxazin-8-amine.
| Compound Name | 1,2,3,5-tetrahydropyrazino[2,1-c][1,4]benzoxazin-8-amine |
|---|---|
| PubChem CID | 142373707 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 1,2,3,5-tetrahydropyrazino[2,1-c][1,4]benzoxazin-8-amine |
| SMILES | Nc1ccc2c(c1)OCC1=CNCCN12 |
| InChI | InChI=1S/C11H13N3O/c12-8-1-2-10-11(5-8)15-7-9-6-13-3-4-14(9)10/h1-2,5-6,13H,3-4,7,12H2 |
| InChIKey | BJRUQWUYARQRDQ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|