C46H32N4OP+ — CID 145334199
3-[3-diphenylphosphoryl-5-[3-(4,6-diphenyl-1,3,5-triazin-1-ium-2-yl)phenyl]phenyl]benzonitrile (PubChem CID 145334199) has the molecular formula C46H32N4OP+ and a molecular weight of 687.76 g/mol. Its IUPAC name is 3-[3-diphenylphosphoryl-5-[3-(4,6-diphenyl-1,3,5-triazin-1-ium-2-yl)phenyl]phenyl]benzonitrile.
| Compound Name | 3-[3-diphenylphosphoryl-5-[3-(4,6-diphenyl-1,3,5-triazin-1-ium-2-yl)phenyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 145334199 |
| Molecular Formula | C46H32N4OP+ |
| Molecular Weight | 687.76 g/mol |
| Exact Mass | 687.23 |
| IUPAC Name | 3-[3-diphenylphosphoryl-5-[3-(4,6-diphenyl-1,3,5-triazin-1-ium-2-yl)phenyl]phenyl]benzonitrile |
| SMILES | N#Cc1cccc(-c2cc(-c3cccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)[nH+]4)c3)cc(P(=O)(c3ccccc3)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C46H31N4OP/c47-32-33-15-13-20-36(27-33)39-29-40(31-43(30-39)52(51,41-23-9-3-10-24-41)42-25-11-4-12-26-42)37-21-14-22-38(28-37)46-49-44(34-16-5-1-6-17-34)48-45(50-46)35-18-7-2-8-19-35/h1-31H/p+1 |
| InChIKey | BIZVHDCZGUVLIC-UHFFFAOYSA-O |
| XLogP | 9.14 |
| TPSA | 80.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.76 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|