C15H26O3 — CID 145337277
[(1R,2R,4aS)-2-methoxy-1,4a-dimethylspiro[3,4,5,7,8,8a-hexahydro-2H-naphthalene-6,2'-oxirane]-1-yl]methanol (PubChem CID 145337277) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is [(1R,2R,4aS)-2-methoxy-1,4a-dimethylspiro[3,4,5,7,8,8a-hexahydro-2H-naphthalene-6,2'-oxirane]-1-yl]methanol.
| Compound Name | [(1R,2R,4aS)-2-methoxy-1,4a-dimethylspiro[3,4,5,7,8,8a-hexahydro-2H-naphthalene-6,2'-oxirane]-1-yl]methanol |
|---|---|
| PubChem CID | 145337277 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | [(1R,2R,4aS)-2-methoxy-1,4a-dimethylspiro[3,4,5,7,8,8a-hexahydro-2H-naphthalene-6,2'-oxirane]-1-yl]methanol |
| SMILES | CO[C@@H]1CC[C@@]2(C)CC3(CCC2[C@]1(C)CO)CO3 |
| InChI | InChI=1S/C15H26O3/c1-13-6-5-12(17-3)14(2,9-16)11(13)4-7-15(8-13)10-18-15/h11-12,16H,4-10H2,1-3H3/t11?,12-,13+,14+,15?/m1/s1 |
| InChIKey | VOVNVYCJAHRDAM-IUWDBWQKSA-N |
| XLogP | 2.37 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|