C19H32O — CID 134775196
(2R,5R,8S,11R)-11-methoxy-2,6,6,8-tetramethyl-2-prop-2-enyltricyclo[6.3.0.01,5]undecane (PubChem CID 134775196) has the molecular formula C19H32O and a molecular weight of 276.46 g/mol. Its IUPAC name is (2R,5R,8S,11R)-11-methoxy-2,6,6,8-tetramethyl-2-prop-2-enyltricyclo[6.3.0.01,5]undecane.
| Compound Name | (2R,5R,8S,11R)-11-methoxy-2,6,6,8-tetramethyl-2-prop-2-enyltricyclo[6.3.0.01,5]undecane |
|---|---|
| PubChem CID | 134775196 |
| Molecular Formula | C19H32O |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.25 |
| IUPAC Name | (2R,5R,8S,11R)-11-methoxy-2,6,6,8-tetramethyl-2-prop-2-enyltricyclo[6.3.0.01,5]undecane |
| SMILES | C=CC[C@@]1(C)CCC2C(C)(C)C[C@]3(C)CC[C@@H](OC)C213 |
| InChI | InChI=1S/C19H32O/c1-7-10-17(4)11-8-14-16(2,3)13-18(5)12-9-15(20-6)19(14,17)18/h7,14-15H,1,8-13H2,2-6H3/t14?,15-,17+,18+,19?/m1/s1 |
| InChIKey | WBPMONJNDURAQM-HBMAJHCESA-N |
| XLogP | 5.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|