C16H28N2O — CID 145341854
ethane;1-[4-[(3E)-6-methylhepta-1,3,5-trien-3-yl]piperazin-1-yl]ethanone (PubChem CID 145341854) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is ethane;1-[4-[(3E)-6-methylhepta-1,3,5-trien-3-yl]piperazin-1-yl]ethanone.
| Compound Name | ethane;1-[4-[(3E)-6-methylhepta-1,3,5-trien-3-yl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 145341854 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | ethane;1-[4-[(3E)-6-methylhepta-1,3,5-trien-3-yl]piperazin-1-yl]ethanone |
| SMILES | C=C/C(=C\C=C(C)C)N1CCN(C(C)=O)CC1.CC |
| InChI | InChI=1S/C14H22N2O.C2H6/c1-5-14(7-6-12(2)3)16-10-8-15(9-11-16)13(4)17;1-2/h5-7H,1,8-11H2,2-4H3;1-2H3/b14-7+; |
| InChIKey | BXUJVQDBZMNAKN-FJUODKGNSA-N |
| XLogP | 3.21 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|