C22H21F6N5O3S — CID 145347095
(E)-3-[(2Z)-2-[amino-[3,5-bis(trifluoromethyl)phenyl]methylidene]hydrazinyl]-2-(4-pyrrolidin-1-ylsulfonylphenyl)prop-2-enamide (PubChem CID 145347095) has the molecular formula C22H21F6N5O3S and a molecular weight of 549.50 g/mol. Its IUPAC name is (E)-3-[(2Z)-2-[amino-[3,5-bis(trifluoromethyl)phenyl]methylidene]hydrazinyl]-2-(4-pyrrolidin-1-ylsulfonylphenyl)prop-2-enamide.
| Compound Name | (E)-3-[(2Z)-2-[amino-[3,5-bis(trifluoromethyl)phenyl]methylidene]hydrazinyl]-2-(4-pyrrolidin-1-ylsulfonylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 145347095 |
| Molecular Formula | C22H21F6N5O3S |
| Molecular Weight | 549.50 g/mol |
| Exact Mass | 549.13 |
| IUPAC Name | (E)-3-[(2Z)-2-[amino-[3,5-bis(trifluoromethyl)phenyl]methylidene]hydrazinyl]-2-(4-pyrrolidin-1-ylsulfonylphenyl)prop-2-enamide |
| SMILES | NC(=O)/C(=C/N/N=C(\N)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C22H21F6N5O3S/c23-21(24,25)15-9-14(10-16(11-15)22(26,27)28)19(29)32-31-12-18(20(30)34)13-3-5-17(6-4-13)37(35,36)33-7-1-2-8-33/h3-6,9-12,31H,1-2,7-8H2,(H2,29,32)(H2,30,34)/b18-12+ |
| InChIKey | HFZLZCJNWHCMKD-LDADJPATSA-N |
| XLogP | 3.24 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|