C15H19NO — CID 145356897
2-(cyclohexylamino)-2,3-dihydroinden-1-one (PubChem CID 145356897) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is 2-(cyclohexylamino)-2,3-dihydroinden-1-one.
| Compound Name | 2-(cyclohexylamino)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 145356897 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 2-(cyclohexylamino)-2,3-dihydroinden-1-one |
| SMILES | O=C1c2ccccc2CC1NC1CCCCC1 |
| InChI | InChI=1S/C15H19NO/c17-15-13-9-5-4-6-11(13)10-14(15)16-12-7-2-1-3-8-12/h4-6,9,12,14,16H,1-3,7-8,10H2 |
| InChIKey | SWIWWXRYTKQEBQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |