C16H21OS+ — CID 22974589
cyclohexyl-methyl-(3-oxo-1,2-dihydroinden-2-yl)sulfanium (PubChem CID 22974589) has the molecular formula C16H21OS+ and a molecular weight of 261.41 g/mol. Its IUPAC name is cyclohexyl-methyl-(3-oxo-1,2-dihydroinden-2-yl)sulfanium.
| Compound Name | cyclohexyl-methyl-(3-oxo-1,2-dihydroinden-2-yl)sulfanium |
|---|---|
| PubChem CID | 22974589 |
| Molecular Formula | C16H21OS+ |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | cyclohexyl-methyl-(3-oxo-1,2-dihydroinden-2-yl)sulfanium |
| SMILES | C[S+](C1CCCCC1)C1Cc2ccccc2C1=O |
| InChI | InChI=1S/C16H21OS/c1-18(13-8-3-2-4-9-13)15-11-12-7-5-6-10-14(12)16(15)17/h5-7,10,13,15H,2-4,8-9,11H2,1H3/q+1 |
| InChIKey | SHBCYFCZFYMUKB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|