C15H18O2 — CID 79428633
2-(oxan-2-ylmethyl)-2,3-dihydroinden-1-one (PubChem CID 79428633) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is 2-(oxan-2-ylmethyl)-2,3-dihydroinden-1-one.
| Compound Name | 2-(oxan-2-ylmethyl)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 79428633 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 2-(oxan-2-ylmethyl)-2,3-dihydroinden-1-one |
| SMILES | O=C1c2ccccc2CC1CC1CCCCO1 |
| InChI | InChI=1S/C15H18O2/c16-15-12(10-13-6-3-4-8-17-13)9-11-5-1-2-7-14(11)15/h1-2,5,7,12-13H,3-4,6,8-10H2 |
| InChIKey | DKVLIBRAFASAPT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |