C17H25N3O4 — CID 145365464
tert-butyl N-[(3Z)-3-[1-cyano-2-(methylamino)-2-oxoethylidene]-5-methylcyclohexen-1-yl]carbamate;formaldehyde (PubChem CID 145365464) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is tert-butyl N-[(3Z)-3-[1-cyano-2-(methylamino)-2-oxoethylidene]-5-methylcyclohexen-1-yl]carbamate;formaldehyde.
| Compound Name | tert-butyl N-[(3Z)-3-[1-cyano-2-(methylamino)-2-oxoethylidene]-5-methylcyclohexen-1-yl]carbamate;formaldehyde |
|---|---|
| PubChem CID | 145365464 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | tert-butyl N-[(3Z)-3-[1-cyano-2-(methylamino)-2-oxoethylidene]-5-methylcyclohexen-1-yl]carbamate;formaldehyde |
| SMILES | C=O.CNC(=O)/C(C#N)=C1\C=C(NC(=O)OC(C)(C)C)CC(C)C1 |
| InChI | InChI=1S/C16H23N3O3.CH2O/c1-10-6-11(13(9-17)14(20)18-5)8-12(7-10)19-15(21)22-16(2,3)4;1-2/h8,10H,6-7H2,1-5H3,(H,18,20)(H,19,21);1H2/b13-11-; |
| InChIKey | ZPPVNTMDTZEXNQ-KEHAOADBSA-N |
| XLogP | 2.21 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|