C33H39N5 — CID 145371897
4-[3-[(1-benzyl-4-phenylcyclohexyl)amino]-1-phenylpropyl]pyridine-2,3,6-triamine (PubChem CID 145371897) has the molecular formula C33H39N5 and a molecular weight of 505.71 g/mol. Its IUPAC name is 4-[3-[(1-benzyl-4-phenylcyclohexyl)amino]-1-phenylpropyl]pyridine-2,3,6-triamine.
| Compound Name | 4-[3-[(1-benzyl-4-phenylcyclohexyl)amino]-1-phenylpropyl]pyridine-2,3,6-triamine |
|---|---|
| PubChem CID | 145371897 |
| Molecular Formula | C33H39N5 |
| Molecular Weight | 505.71 g/mol |
| Exact Mass | 505.32 |
| IUPAC Name | 4-[3-[(1-benzyl-4-phenylcyclohexyl)amino]-1-phenylpropyl]pyridine-2,3,6-triamine |
| SMILES | Nc1cc(C(CCNC2(Cc3ccccc3)CCC(c3ccccc3)CC2)c2ccccc2)c(N)c(N)n1 |
| InChI | InChI=1S/C33H39N5/c34-30-22-29(31(35)32(36)38-30)28(27-14-8-3-9-15-27)18-21-37-33(23-24-10-4-1-5-11-24)19-16-26(17-20-33)25-12-6-2-7-13-25/h1-15,22,26,28,37H,16-21,23,35H2,(H4,34,36,38) |
| InChIKey | MJXFDDMJEDAOSF-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 102.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.71 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |