C60H84O9 — CID 145374207
[(Z,1E)-1-(2-oxocyclopent-3-en-1-ylidene)oct-5-en-3-yl] (Z)-hept-5-enoate (PubChem CID 145374207) has the molecular formula C60H84O9 and a molecular weight of 949.32 g/mol. Its IUPAC name is [(Z,1E)-1-(2-oxocyclopent-3-en-1-ylidene)oct-5-en-3-yl] (Z)-hept-5-enoate.
| Compound Name | [(Z,1E)-1-(2-oxocyclopent-3-en-1-ylidene)oct-5-en-3-yl] (Z)-hept-5-enoate |
|---|---|
| PubChem CID | 145374207 |
| Molecular Formula | C60H84O9 |
| Molecular Weight | 949.32 g/mol |
| Exact Mass | 948.61 |
| IUPAC Name | [(Z,1E)-1-(2-oxocyclopent-3-en-1-ylidene)oct-5-en-3-yl] (Z)-hept-5-enoate |
| SMILES | C/C=C\CCCC(=O)OC(C/C=C\CC)C/C=C1\CC=CC1=O.C/C=C\CCCC(=O)OC(C/C=C\CC)C/C=C1\CC=CC1=O.C/C=C\CCCC(=O)OC(C/C=C\CC)C/C=C1\CC=CC1=O |
| InChI | InChI=1S/3C20H28O3/c3*1-3-5-7-9-14-20(22)23-18(12-8-6-4-2)16-15-17-11-10-13-19(17)21/h3*3,5-6,8,10,13,15,18H,4,7,9,11-12,14,16H2,1-2H3/b3*5-3-,8-6-,17-15+ |
| InChIKey | FHZWBAUGCYWHHW-IIUMMOGISA-N |
| XLogP | 14.54 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 949.32 |
| LogP ≤ 5 | 14.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|