C23H33F3O3 — CID 145374141
ethane;[(Z,1E)-8,8,8-trifluoro-1-(3-methyl-2-oxocyclopent-3-en-1-ylidene)oct-5-en-3-yl] (Z)-hept-5-enoate (PubChem CID 145374141) has the molecular formula C23H33F3O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is ethane;[(Z,1E)-8,8,8-trifluoro-1-(3-methyl-2-oxocyclopent-3-en-1-ylidene)oct-5-en-3-yl] (Z)-hept-5-enoate.
| Compound Name | ethane;[(Z,1E)-8,8,8-trifluoro-1-(3-methyl-2-oxocyclopent-3-en-1-ylidene)oct-5-en-3-yl] (Z)-hept-5-enoate |
|---|---|
| PubChem CID | 145374141 |
| Molecular Formula | C23H33F3O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | ethane;[(Z,1E)-8,8,8-trifluoro-1-(3-methyl-2-oxocyclopent-3-en-1-ylidene)oct-5-en-3-yl] (Z)-hept-5-enoate |
| SMILES | C/C=C\CCCC(=O)OC(C/C=C\CC(F)(F)F)C/C=C1\CC=C(C)C1=O.CC |
| InChI | InChI=1S/C21H27F3O3.C2H6/c1-3-4-5-6-10-19(25)27-18(9-7-8-15-21(22,23)24)14-13-17-12-11-16(2)20(17)26;1-2/h3-4,7-8,11,13,18H,5-6,9-10,12,14-15H2,1-2H3;1-2H3/b4-3-,8-7-,17-13+; |
| InChIKey | DRQQQLDGPFYHJC-WDBOLFRXSA-N |
| XLogP | 6.81 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|