C20H26ClF3O3 — CID 130467729
[(1E)-1-(3-chloro-2-oxocyclopent-3-en-1-ylidene)-8,8,8-trifluorooctan-3-yl] (Z)-hept-5-enoate (PubChem CID 130467729) has the molecular formula C20H26ClF3O3 and a molecular weight of 406.87 g/mol. Its IUPAC name is [(1E)-1-(3-chloro-2-oxocyclopent-3-en-1-ylidene)-8,8,8-trifluorooctan-3-yl] (Z)-hept-5-enoate.
| Compound Name | [(1E)-1-(3-chloro-2-oxocyclopent-3-en-1-ylidene)-8,8,8-trifluorooctan-3-yl] (Z)-hept-5-enoate |
|---|---|
| PubChem CID | 130467729 |
| Molecular Formula | C20H26ClF3O3 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | [(1E)-1-(3-chloro-2-oxocyclopent-3-en-1-ylidene)-8,8,8-trifluorooctan-3-yl] (Z)-hept-5-enoate |
| SMILES | C/C=C\CCCC(=O)OC(C/C=C1\CC=C(Cl)C1=O)CCCCC(F)(F)F |
| InChI | InChI=1S/C20H26ClF3O3/c1-2-3-4-5-9-18(25)27-16(8-6-7-14-20(22,23)24)12-10-15-11-13-17(21)19(15)26/h2-3,10,13,16H,4-9,11-12,14H2,1H3/b3-2-,15-10+ |
| InChIKey | ONKPQPRPIKCTLY-GOYXIKCASA-N |
| XLogP | 6.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|