C9H14N2O3 — CID 145374973
3-amino-2-(2,5-dioxopyrrol-1-yl)propanal;ethane (PubChem CID 145374973) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is 3-amino-2-(2,5-dioxopyrrol-1-yl)propanal;ethane.
| Compound Name | 3-amino-2-(2,5-dioxopyrrol-1-yl)propanal;ethane |
|---|---|
| PubChem CID | 145374973 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 3-amino-2-(2,5-dioxopyrrol-1-yl)propanal;ethane |
| SMILES | CC.NCC(C=O)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C7H8N2O3.C2H6/c8-3-5(4-10)9-6(11)1-2-7(9)12;1-2/h1-2,4-5H,3,8H2;1-2H3 |
| InChIKey | SACILIDLTRVSTC-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|