About 2-aminoacetaldehyde;5-methylidene-1-propan-2-ylpyrrol-2-one;2-methylpentane
2-aminoacetaldehyde;5-methylidene-1-propan-2-ylpyrrol-2-one;2-methylpentane (PubChem CID 162444116) has the molecular formula C16H30N2O2
and a molecular weight of 282.43 g/mol. Its IUPAC name is 2-aminoacetaldehyde;5-methylidene-1-propan-2-ylpyrrol-2-one;2-methylpentane.
Molecular Properties
| Compound Name | 2-aminoacetaldehyde;5-methylidene-1-propan-2-ylpyrrol-2-one;2-methylpentane |
| PubChem CID | 162444116 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | 2-aminoacetaldehyde;5-methylidene-1-propan-2-ylpyrrol-2-one;2-methylpentane |
| SMILES | C=C1C=CC(=O)N1C(C)C.CCCC(C)C.NCC=O |
| InChI | InChI=1S/C8H11NO.C6H14.C2H5NO/c1-6(2)9-7(3)4-5-8(9)10;1-4-5-6(2)3;3-1-2-4/h4-6H,3H2,1-2H3;6H,4-5H2,1-3H3;2H,1,3H2 |
| InChIKey | ADPCMROMJLHUAD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoacetaldehyde;5-methylidene-1-propan-2-ylpyrrol-2-one;2-methylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoacetaldehyde;5-methylidene-1-propan-2-ylpyrrol-2-one;2-methylpentane?
The IUPAC name of 2-aminoacetaldehyde;5-methylidene-1-propan-2-ylpyrrol-2-one;2-methylpentane (CID 162444116) is 2-aminoacetaldehyde;5-methylidene-1-propan-2-ylpyrrol-2-one;2-methylpentane.
What is the SMILES notation for 2-aminoacetaldehyde;5-methylidene-1-propan-2-ylpyrrol-2-one;2-methylpentane?
The canonical SMILES for 2-aminoacetaldehyde;5-methylidene-1-propan-2-ylpyrrol-2-one;2-methylpentane is C=C1C=CC(=O)N1C(C)C.CCCC(C)C.NCC=O.
What is the InChIKey of 2-aminoacetaldehyde;5-methylidene-1-propan-2-ylpyrrol-2-one;2-methylpentane?
The InChIKey is ADPCMROMJLHUAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO.C6H14.C2H5NO/c1-6(2)9-7(3)4-5-8(9)10;1-4-5-6(2)3;3-1-2-4/h4-6H,3H2,1-2H3;6H,4-5H2,1-3H3;2H,1,3H2.
What are the key properties of 2-aminoacetaldehyde;5-methylidene-1-propan-2-ylpyrrol-2-one;2-methylpentane?
2-aminoacetaldehyde;5-methylidene-1-propan-2-ylpyrrol-2-one;2-methylpentane has a molecular weight of 282.43 g/mol, XLogP of 2.89, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoacetaldehyde;5-methylidene-1-propan-2-ylpyrrol-2-one;2-methylpentane is sourced from PubChem (CID 162444116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).