C15H19NO2 — CID 145377813
(3E,4E)-3,4-di(ethylidene)-1-[(2E,4Z)-hepta-2,4-dien-3-yl]pyrrolidine-2,5-dione (PubChem CID 145377813) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is (3E,4E)-3,4-di(ethylidene)-1-[(2E,4Z)-hepta-2,4-dien-3-yl]pyrrolidine-2,5-dione.
| Compound Name | (3E,4E)-3,4-di(ethylidene)-1-[(2E,4Z)-hepta-2,4-dien-3-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 145377813 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | (3E,4E)-3,4-di(ethylidene)-1-[(2E,4Z)-hepta-2,4-dien-3-yl]pyrrolidine-2,5-dione |
| SMILES | C/C=C1/C(=O)N(C(/C=C\CC)=C/C)C(=O)/C1=C/C |
| InChI | InChI=1S/C15H19NO2/c1-5-9-10-11(6-2)16-14(17)12(7-3)13(8-4)15(16)18/h6-10H,5H2,1-4H3/b10-9-,11-6+,12-7+,13-8+ |
| InChIKey | MZMSRXLDNHZOHT-NEEDLKESSA-N |
| XLogP | 3.12 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|