C18H20BrN — CID 145380003
6-bromo-1-(4-methylphenyl)-3,4-dihydroisoquinoline;ethane (PubChem CID 145380003) has the molecular formula C18H20BrN and a molecular weight of 330.27 g/mol. Its IUPAC name is 6-bromo-1-(4-methylphenyl)-3,4-dihydroisoquinoline;ethane.
| Compound Name | 6-bromo-1-(4-methylphenyl)-3,4-dihydroisoquinoline;ethane |
|---|---|
| PubChem CID | 145380003 |
| Molecular Formula | C18H20BrN |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 6-bromo-1-(4-methylphenyl)-3,4-dihydroisoquinoline;ethane |
| SMILES | CC.Cc1ccc(C2=NCCc3cc(Br)ccc32)cc1 |
| InChI | InChI=1S/C16H14BrN.C2H6/c1-11-2-4-12(5-3-11)16-15-7-6-14(17)10-13(15)8-9-18-16;1-2/h2-7,10H,8-9H2,1H3;1-2H3 |
| InChIKey | UAIUAHXGAHPVNT-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |