C12H19FO2S — CID 145380309
(2Z,4Z,6E)-5-fluoro-8,8-dimethyl-4-methylsulfonylnona-2,4,6-triene (PubChem CID 145380309) has the molecular formula C12H19FO2S and a molecular weight of 246.35 g/mol. Its IUPAC name is (2Z,4Z,6E)-5-fluoro-8,8-dimethyl-4-methylsulfonylnona-2,4,6-triene.
| Compound Name | (2Z,4Z,6E)-5-fluoro-8,8-dimethyl-4-methylsulfonylnona-2,4,6-triene |
|---|---|
| PubChem CID | 145380309 |
| Molecular Formula | C12H19FO2S |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | (2Z,4Z,6E)-5-fluoro-8,8-dimethyl-4-methylsulfonylnona-2,4,6-triene |
| SMILES | C/C=C\C(=C(F)/C=C/C(C)(C)C)S(C)(=O)=O |
| InChI | InChI=1S/C12H19FO2S/c1-6-7-11(16(5,14)15)10(13)8-9-12(2,3)4/h6-9H,1-5H3/b7-6-,9-8+,11-10- |
| InChIKey | IBAQXBAPARWWNJ-KDQYYBQISA-N |
| XLogP | 3.39 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|