C11H24NP — CID 145381848
[(E)-but-1-enyl]phosphane;3,4-dimethylpentan-1-imine (PubChem CID 145381848) has the molecular formula C11H24NP and a molecular weight of 201.29 g/mol. Its IUPAC name is [(E)-but-1-enyl]phosphane;3,4-dimethylpentan-1-imine.
| Compound Name | [(E)-but-1-enyl]phosphane;3,4-dimethylpentan-1-imine |
|---|---|
| PubChem CID | 145381848 |
| Molecular Formula | C11H24NP |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.16 |
| IUPAC Name | [(E)-but-1-enyl]phosphane;3,4-dimethylpentan-1-imine |
| SMILES | CC/C=C/P.[H]/N=C/CC(C)C(C)C |
| InChI | InChI=1S/C7H15N.C4H9P/c1-6(2)7(3)4-5-8;1-2-3-4-5/h5-8H,4H2,1-3H3;3-4H,2,5H2,1H3/b8-5+;4-3+ |
| InChIKey | KALNOMCGRPLASR-NNEAENLQSA-N |
| XLogP | 4.10 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|