C19H26 — CID 145385703
1-methyl-4-(3-methyl-2-methylidenebut-3-enyl)-5-prop-1-en-2-yl-2-propylbenzene (PubChem CID 145385703) has the molecular formula C19H26 and a molecular weight of 254.42 g/mol. Its IUPAC name is 1-methyl-4-(3-methyl-2-methylidenebut-3-enyl)-5-prop-1-en-2-yl-2-propylbenzene.
| Compound Name | 1-methyl-4-(3-methyl-2-methylidenebut-3-enyl)-5-prop-1-en-2-yl-2-propylbenzene |
|---|---|
| PubChem CID | 145385703 |
| Molecular Formula | C19H26 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | 1-methyl-4-(3-methyl-2-methylidenebut-3-enyl)-5-prop-1-en-2-yl-2-propylbenzene |
| SMILES | C=C(C)C(=C)Cc1cc(CCC)c(C)cc1C(=C)C |
| InChI | InChI=1S/C19H26/c1-8-9-17-12-18(10-15(6)13(2)3)19(14(4)5)11-16(17)7/h11-12H,2,4,6,8-10H2,1,3,5,7H3 |
| InChIKey | GKLYADZCPIRPJJ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|